C18H28N4O5 — CID 123968517
3-(cyclopentylmethyl)-N-hydroxy-4-[3-(morpholine-4-carbonyl)-3,4-dihydropyrazol-2-yl]-4-oxobutanamide (PubChem CID 123968517) has the molecular formula C18H28N4O5 and a molecular weight of 380.45 g/mol. Its IUPAC name is 3-(cyclopentylmethyl)-N-hydroxy-4-[3-(morpholine-4-carbonyl)-3,4-dihydropyrazol-2-yl]-4-oxobutanamide.
| Compound Name | 3-(cyclopentylmethyl)-N-hydroxy-4-[3-(morpholine-4-carbonyl)-3,4-dihydropyrazol-2-yl]-4-oxobutanamide |
|---|---|
| PubChem CID | 123968517 |
| Molecular Formula | C18H28N4O5 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 3-(cyclopentylmethyl)-N-hydroxy-4-[3-(morpholine-4-carbonyl)-3,4-dihydropyrazol-2-yl]-4-oxobutanamide |
| SMILES | O=C(CC(CC1CCCC1)C(=O)N1N=CCC1C(=O)N1CCOCC1)NO |
| InChI | InChI=1S/C18H28N4O5/c23-16(20-26)12-14(11-13-3-1-2-4-13)17(24)22-15(5-6-19-22)18(25)21-7-9-27-10-8-21/h6,13-15,26H,1-5,7-12H2,(H,20,23) |
| InChIKey | DHWUDUWIKYMDJD-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 111.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|