C20H27Cl2N3O3 — CID 59979568
(3R)-3-(cyclopentylmethyl)-4-[4-(3,4-dichlorophenyl)piperazin-1-yl]-N-hydroxy-4-oxobutanamide (PubChem CID 59979568) has the molecular formula C20H27Cl2N3O3 and a molecular weight of 428.36 g/mol. Its IUPAC name is (3R)-3-(cyclopentylmethyl)-4-[4-(3,4-dichlorophenyl)piperazin-1-yl]-N-hydroxy-4-oxobutanamide.
| Compound Name | (3R)-3-(cyclopentylmethyl)-4-[4-(3,4-dichlorophenyl)piperazin-1-yl]-N-hydroxy-4-oxobutanamide |
|---|---|
| PubChem CID | 59979568 |
| Molecular Formula | C20H27Cl2N3O3 |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | (3R)-3-(cyclopentylmethyl)-4-[4-(3,4-dichlorophenyl)piperazin-1-yl]-N-hydroxy-4-oxobutanamide |
| SMILES | O=C(C[C@@H](CC1CCCC1)C(=O)N1CCN(c2ccc(Cl)c(Cl)c2)CC1)NO |
| InChI | InChI=1S/C20H27Cl2N3O3/c21-17-6-5-16(13-18(17)22)24-7-9-25(10-8-24)20(27)15(12-19(26)23-28)11-14-3-1-2-4-14/h5-6,13-15,28H,1-4,7-12H2,(H,23,26)/t15-/m1/s1 |
| InChIKey | QEMIMGROJUKDKP-OAHLLOKOSA-N |
| XLogP | 3.73 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|