C16H26N4O4 — CID 86706402
(3S)-2-[(2R)-2-(cyclopentylmethyl)-4-(hydroxyamino)-4-oxobutanoyl]-N,N-dimethyl-3,4-dihydropyrazole-3-carboxamide (PubChem CID 86706402) has the molecular formula C16H26N4O4 and a molecular weight of 338.41 g/mol. Its IUPAC name is (3S)-2-[(2R)-2-(cyclopentylmethyl)-4-(hydroxyamino)-4-oxobutanoyl]-N,N-dimethyl-3,4-dihydropyrazole-3-carboxamide.
| Compound Name | (3S)-2-[(2R)-2-(cyclopentylmethyl)-4-(hydroxyamino)-4-oxobutanoyl]-N,N-dimethyl-3,4-dihydropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 86706402 |
| Molecular Formula | C16H26N4O4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | (3S)-2-[(2R)-2-(cyclopentylmethyl)-4-(hydroxyamino)-4-oxobutanoyl]-N,N-dimethyl-3,4-dihydropyrazole-3-carboxamide |
| SMILES | CN(C)C(=O)[C@@H]1CC=NN1C(=O)C(CC(=O)NO)CC1CCCC1 |
| InChI | InChI=1S/C16H26N4O4/c1-19(2)16(23)13-7-8-17-20(13)15(22)12(10-14(21)18-24)9-11-5-3-4-6-11/h8,11-13,24H,3-7,9-10H2,1-2H3,(H,18,21)/t12?,13-/m0/s1 |
| InChIKey | GLUADEVIFXXYRK-ABLWVSNPSA-N |
| XLogP | 0.75 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|