C38H59NO2 — CID 123968792
ethyl 4-[(3a-amino-5b,8,8,11a-tetramethyl-1-prop-1-en-2-yl-2,3,4,5,5a,6,7,7a,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-9-yl)methylidene]cyclohexane-1-carboxylate (PubChem CID 123968792) has the molecular formula C38H59NO2 and a molecular weight of 561.90 g/mol. Its IUPAC name is ethyl 4-[(3a-amino-5b,8,8,11a-tetramethyl-1-prop-1-en-2-yl-2,3,4,5,5a,6,7,7a,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-9-yl)methylidene]cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[(3a-amino-5b,8,8,11a-tetramethyl-1-prop-1-en-2-yl-2,3,4,5,5a,6,7,7a,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-9-yl)methylidene]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 123968792 |
| Molecular Formula | C38H59NO2 |
| Molecular Weight | 561.90 g/mol |
| Exact Mass | 561.45 |
| IUPAC Name | ethyl 4-[(3a-amino-5b,8,8,11a-tetramethyl-1-prop-1-en-2-yl-2,3,4,5,5a,6,7,7a,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-9-yl)methylidene]cyclohexane-1-carboxylate |
| SMILES | C=C(C)C1CCC2(N)CCC3C(CCC4C3(C)CCC3C(C)(C)C(C=C5CCC(C(=O)OCC)CC5)=CCC34C)C12 |
| InChI | InChI=1S/C38H59NO2/c1-8-41-34(40)26-11-9-25(10-12-26)23-27-15-19-37(7)31(35(27,4)5)18-20-36(6)30-17-22-38(39)21-16-28(24(2)3)33(38)29(30)13-14-32(36)37/h15,23,26,28-33H,2,8-14,16-22,39H2,1,3-7H3/b25-23- |
| InChIKey | UBQIWZPNPYVHJW-BZZOAKBMSA-N |
| XLogP | 9.18 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.90 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|