C11H11ClN2 — CID 123969056
5-chloro-7-cyclohexa-1,5-dien-1-yl-1H-1,3-diazepine (PubChem CID 123969056) has the molecular formula C11H11ClN2 and a molecular weight of 206.68 g/mol. Its IUPAC name is 5-chloro-7-cyclohexa-1,5-dien-1-yl-1H-1,3-diazepine.
| Compound Name | 5-chloro-7-cyclohexa-1,5-dien-1-yl-1H-1,3-diazepine |
|---|---|
| PubChem CID | 123969056 |
| Molecular Formula | C11H11ClN2 |
| Molecular Weight | 206.68 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 5-chloro-7-cyclohexa-1,5-dien-1-yl-1H-1,3-diazepine |
| SMILES | ClC1=CN=CNC(C2=CCCC=C2)=C1 |
| InChI | InChI=1S/C11H11ClN2/c12-10-6-11(14-8-13-7-10)9-4-2-1-3-5-9/h2,4-8H,1,3H2,(H,13,14) |
| InChIKey | FQKBOJNHSWLVQX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.68 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |