C8H8N2 — CID 142336208
1,5-dihydroquinazoline (PubChem CID 142336208) has the molecular formula C8H8N2 and a molecular weight of 132.17 g/mol. Its IUPAC name is 1,5-dihydroquinazoline.
| Compound Name | 1,5-dihydroquinazoline |
|---|---|
| PubChem CID | 142336208 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 1,5-dihydroquinazoline |
| SMILES | C1=CCC2=CN=CNC2=C1 |
| InChI | InChI=1S/C8H8N2/c1-2-4-8-7(3-1)5-9-6-10-8/h1-2,4-6H,3H2,(H,9,10) |
| InChIKey | XHCNLCVWSIBVCU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |