C10H14N2 — CID 135393541
7,7-dimethyl-4,8-dihydro-1H-quinazoline (PubChem CID 135393541) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 7,7-dimethyl-4,8-dihydro-1H-quinazoline.
| Compound Name | 7,7-dimethyl-4,8-dihydro-1H-quinazoline |
|---|---|
| PubChem CID | 135393541 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 7,7-dimethyl-4,8-dihydro-1H-quinazoline |
| SMILES | CC1(C)C=CC2=C(C1)NC=NC2 |
| InChI | InChI=1S/C10H14N2/c1-10(2)4-3-8-6-11-7-12-9(8)5-10/h3-4,7H,5-6H2,1-2H3,(H,11,12) |
| InChIKey | ILFMURVRMYHMMS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |