C11H10N2 — CID 129044407
8,9-dihydro-1H-perimidine (PubChem CID 129044407) has the molecular formula C11H10N2 and a molecular weight of 170.22 g/mol. Its IUPAC name is 8,9-dihydro-1H-perimidine.
| Compound Name | 8,9-dihydro-1H-perimidine |
|---|---|
| PubChem CID | 129044407 |
| Molecular Formula | C11H10N2 |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 8,9-dihydro-1H-perimidine |
| SMILES | C1=Nc2cccc3c2=C(CCC=3)N1 |
| InChI | InChI=1S/C11H10N2/c1-3-8-4-2-6-10-11(8)9(5-1)12-7-13-10/h1,3-5,7H,2,6H2,(H,12,13) |
| InChIKey | IZQTXMZIEFWURS-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |