C22H23N3 — CID 123969218
10,10-diethyl-2-phenyl-1,3,11-triazatetracyclo[6.5.2.04,15.011,14]pentadeca-2,4,6,8(15),12-pentaene (PubChem CID 123969218) has the molecular formula C22H23N3 and a molecular weight of 329.45 g/mol. Its IUPAC name is 10,10-diethyl-2-phenyl-1,3,11-triazatetracyclo[6.5.2.04,15.011,14]pentadeca-2,4,6,8(15),12-pentaene.
| Compound Name | 10,10-diethyl-2-phenyl-1,3,11-triazatetracyclo[6.5.2.04,15.011,14]pentadeca-2,4,6,8(15),12-pentaene |
|---|---|
| PubChem CID | 123969218 |
| Molecular Formula | C22H23N3 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 10,10-diethyl-2-phenyl-1,3,11-triazatetracyclo[6.5.2.04,15.011,14]pentadeca-2,4,6,8(15),12-pentaene |
| SMILES | CCC1(CC)Cc2cccc3c2C2N(C=CN21)C(c1ccccc1)=N3 |
| InChI | InChI=1S/C22H23N3/c1-3-22(4-2)15-17-11-8-12-18-19(17)21-24(13-14-25(21)22)20(23-18)16-9-6-5-7-10-16/h5-14,21H,3-4,15H2,1-2H3 |
| InChIKey | RBHOUJDGYDBJCZ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |