C17H14F3N5 — CID 123971983
3-amino-2-diazenyl-3-[3-[(E)-2-[5-(trifluoromethyl)-3-pyridinyl]ethenyl]phenyl]propanenitrile (PubChem CID 123971983) has the molecular formula C17H14F3N5 and a molecular weight of 345.33 g/mol. Its IUPAC name is 3-amino-2-diazenyl-3-[3-[(E)-2-[5-(trifluoromethyl)-3-pyridinyl]ethenyl]phenyl]propanenitrile.
| Compound Name | 3-amino-2-diazenyl-3-[3-[(E)-2-[5-(trifluoromethyl)-3-pyridinyl]ethenyl]phenyl]propanenitrile |
|---|---|
| PubChem CID | 123971983 |
| Molecular Formula | C17H14F3N5 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 3-amino-2-diazenyl-3-[3-[(E)-2-[5-(trifluoromethyl)-3-pyridinyl]ethenyl]phenyl]propanenitrile |
| SMILES | [H]/N=N/C(C#N)C(N)c1cccc(/C=C/c2cncc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C17H14F3N5/c18-17(19,20)14-7-12(9-24-10-14)5-4-11-2-1-3-13(6-11)16(22)15(8-21)25-23/h1-7,9-10,15-16,23H,22H2/b5-4+,25-23+ |
| InChIKey | GNKWKDMATWCDSA-FLBRJLFASA-N |
| XLogP | 4.19 |
| TPSA | 98.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|