C23H25FN4O2 — CID 123972345
4-(2-fluoro-6-methoxyphenyl)-2-(2-morpholin-4-yl-2,3-dihydropyridine-4-carboximidoyl)aniline (PubChem CID 123972345) has the molecular formula C23H25FN4O2 and a molecular weight of 408.48 g/mol. Its IUPAC name is 4-(2-fluoro-6-methoxyphenyl)-2-(2-morpholin-4-yl-2,3-dihydropyridine-4-carboximidoyl)aniline.
| Compound Name | 4-(2-fluoro-6-methoxyphenyl)-2-(2-morpholin-4-yl-2,3-dihydropyridine-4-carboximidoyl)aniline |
|---|---|
| PubChem CID | 123972345 |
| Molecular Formula | C23H25FN4O2 |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 4-(2-fluoro-6-methoxyphenyl)-2-(2-morpholin-4-yl-2,3-dihydropyridine-4-carboximidoyl)aniline |
| SMILES | [H]/N=C(\C1=CC=NC(N2CCOCC2)C1)c1cc(-c2c(F)cccc2OC)ccc1N |
| InChI | InChI=1S/C23H25FN4O2/c1-29-20-4-2-3-18(24)22(20)15-5-6-19(25)17(13-15)23(26)16-7-8-27-21(14-16)28-9-11-30-12-10-28/h2-8,13,21,26H,9-12,14,25H2,1H3/b26-23+ |
| InChIKey | KBOQSZWPTBDTSE-WNAAXNPUSA-N |
| XLogP | 3.51 |
| TPSA | 83.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|