C17H34 — CID 123972769
8-ethyl-3,3,4,7,8-pentamethyldec-4-ene (PubChem CID 123972769) has the molecular formula C17H34 and a molecular weight of 238.46 g/mol. Its IUPAC name is 8-ethyl-3,3,4,7,8-pentamethyldec-4-ene.
| Compound Name | 8-ethyl-3,3,4,7,8-pentamethyldec-4-ene |
|---|---|
| PubChem CID | 123972769 |
| Molecular Formula | C17H34 |
| Molecular Weight | 238.46 g/mol |
| Exact Mass | 238.27 |
| IUPAC Name | 8-ethyl-3,3,4,7,8-pentamethyldec-4-ene |
| SMILES | CCC(C)(C)C(C)=CCC(C)C(C)(CC)CC |
| InChI | InChI=1S/C17H34/c1-9-16(6,7)14(4)12-13-15(5)17(8,10-2)11-3/h12,15H,9-11,13H2,1-8H3 |
| InChIKey | IYKXDLKJYVVSLZ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.46 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|