C16H32O — CID 88968566
(E)-3,3,4,7,7,8-hexamethyldec-4-en-1-ol (PubChem CID 88968566) has the molecular formula C16H32O and a molecular weight of 240.43 g/mol. Its IUPAC name is (E)-3,3,4,7,7,8-hexamethyldec-4-en-1-ol.
| Compound Name | (E)-3,3,4,7,7,8-hexamethyldec-4-en-1-ol |
|---|---|
| PubChem CID | 88968566 |
| Molecular Formula | C16H32O |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.25 |
| IUPAC Name | (E)-3,3,4,7,7,8-hexamethyldec-4-en-1-ol |
| SMILES | CCC(C)C(C)(C)C/C=C(\C)C(C)(C)CCO |
| InChI | InChI=1S/C16H32O/c1-8-13(2)15(4,5)10-9-14(3)16(6,7)11-12-17/h9,13,17H,8,10-12H2,1-7H3/b14-9+ |
| InChIKey | IWXACQPBUXFDCY-NTEUORMPSA-N |
| XLogP | 4.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|