C25H15F3N6O — CID 123973024
5-[4-(7-isocyanoquinolin-4-yl)oxyphenyl]-N-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-3-amine (PubChem CID 123973024) has the molecular formula C25H15F3N6O and a molecular weight of 472.43 g/mol. Its IUPAC name is 5-[4-(7-isocyanoquinolin-4-yl)oxyphenyl]-N-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-[4-(7-isocyanoquinolin-4-yl)oxyphenyl]-N-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 123973024 |
| Molecular Formula | C25H15F3N6O |
| Molecular Weight | 472.43 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 5-[4-(7-isocyanoquinolin-4-yl)oxyphenyl]-N-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-3-amine |
| SMILES | [C-]#[N+]c1ccc2c(Oc3ccc(-c4nc(Nc5cccc(C(F)(F)F)c5)n[nH]4)cc3)ccnc2c1 |
| InChI | InChI=1S/C25H15F3N6O/c1-29-17-7-10-20-21(14-17)30-12-11-22(20)35-19-8-5-15(6-9-19)23-32-24(34-33-23)31-18-4-2-3-16(13-18)25(26,27)28/h2-14H,(H2,31,32,33,34) |
| InChIKey | SPSYFHRXWGKLAF-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 80.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.43 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|