C19H19NO4S — CID 123974400
4-hydroxy-5-[[4-(2-oxo-3-prop-1-enylhexa-3,5-dienoxy)phenyl]methyl]-3H-1,3-thiazol-2-one (PubChem CID 123974400) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is 4-hydroxy-5-[[4-(2-oxo-3-prop-1-enylhexa-3,5-dienoxy)phenyl]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-hydroxy-5-[[4-(2-oxo-3-prop-1-enylhexa-3,5-dienoxy)phenyl]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 123974400 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 4-hydroxy-5-[[4-(2-oxo-3-prop-1-enylhexa-3,5-dienoxy)phenyl]methyl]-3H-1,3-thiazol-2-one |
| SMILES | C=CC=C(C=CC)C(=O)COc1ccc(Cc2sc(=O)[nH]c2O)cc1 |
| InChI | InChI=1S/C19H19NO4S/c1-3-5-14(6-4-2)16(21)12-24-15-9-7-13(8-10-15)11-17-18(22)20-19(23)25-17/h3-10,22H,1,11-12H2,2H3,(H,20,23) |
| InChIKey | NMHGJOBOZKBEDD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|