C16H15Cl2N3O2 — CID 123975937
4-[2-[5-(3,4-dichloroanilino)-1,3,4-oxadiazol-2-yl]ethyl]cyclohex-3-en-1-one (PubChem CID 123975937) has the molecular formula C16H15Cl2N3O2 and a molecular weight of 352.22 g/mol. Its IUPAC name is 4-[2-[5-(3,4-dichloroanilino)-1,3,4-oxadiazol-2-yl]ethyl]cyclohex-3-en-1-one.
| Compound Name | 4-[2-[5-(3,4-dichloroanilino)-1,3,4-oxadiazol-2-yl]ethyl]cyclohex-3-en-1-one |
|---|---|
| PubChem CID | 123975937 |
| Molecular Formula | C16H15Cl2N3O2 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 4-[2-[5-(3,4-dichloroanilino)-1,3,4-oxadiazol-2-yl]ethyl]cyclohex-3-en-1-one |
| SMILES | O=C1CC=C(CCc2nnc(Nc3ccc(Cl)c(Cl)c3)o2)CC1 |
| InChI | InChI=1S/C16H15Cl2N3O2/c17-13-7-4-11(9-14(13)18)19-16-21-20-15(23-16)8-3-10-1-5-12(22)6-2-10/h1,4,7,9H,2-3,5-6,8H2,(H,19,21) |
| InChIKey | UKZONHBZNGYXLD-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|