C15H21ClN2O2 — CID 123976320
N-[1-(4-chlorophenoxy)-3,3-dimethyl-2-oxobutyl]-N,N'-dimethylmethanimidamide (PubChem CID 123976320) has the molecular formula C15H21ClN2O2 and a molecular weight of 296.80 g/mol. Its IUPAC name is N-[1-(4-chlorophenoxy)-3,3-dimethyl-2-oxobutyl]-N,N'-dimethylmethanimidamide.
| Compound Name | N-[1-(4-chlorophenoxy)-3,3-dimethyl-2-oxobutyl]-N,N'-dimethylmethanimidamide |
|---|---|
| PubChem CID | 123976320 |
| Molecular Formula | C15H21ClN2O2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | N-[1-(4-chlorophenoxy)-3,3-dimethyl-2-oxobutyl]-N,N'-dimethylmethanimidamide |
| SMILES | C/N=C/N(C)C(Oc1ccc(Cl)cc1)C(=O)C(C)(C)C |
| InChI | InChI=1S/C15H21ClN2O2/c1-15(2,3)13(19)14(18(5)10-17-4)20-12-8-6-11(16)7-9-12/h6-10,14H,1-5H3/b17-10+ |
| InChIKey | NJIODMQNBKOYSK-LICLKQGHSA-N |
| XLogP | 3.25 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|