C15H19BrClNO4 — CID 21319239
[4-bromo-4-(4-chlorophenoxy)-2,2-dimethyl-3-oxobutyl] N,N-dimethylcarbamate (PubChem CID 21319239) has the molecular formula C15H19BrClNO4 and a molecular weight of 392.68 g/mol. Its IUPAC name is [4-bromo-4-(4-chlorophenoxy)-2,2-dimethyl-3-oxobutyl] N,N-dimethylcarbamate.
| Compound Name | [4-bromo-4-(4-chlorophenoxy)-2,2-dimethyl-3-oxobutyl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 21319239 |
| Molecular Formula | C15H19BrClNO4 |
| Molecular Weight | 392.68 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | [4-bromo-4-(4-chlorophenoxy)-2,2-dimethyl-3-oxobutyl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)OCC(C)(C)C(=O)C(Br)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H19BrClNO4/c1-15(2,9-21-14(20)18(3)4)12(19)13(16)22-11-7-5-10(17)6-8-11/h5-8,13H,9H2,1-4H3 |
| InChIKey | KWJMTYXNROIQIU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.68 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|