About [4-bromo-4-(4-chlorophenoxy)-2,2-dimethyl-3-oxobutyl] N,N-dimethylcarbamate
[4-bromo-4-(4-chlorophenoxy)-2,2-dimethyl-3-oxobutyl] N,N-dimethylcarbamate (PubChem CID 21319239) has the molecular formula C15H19BrClNO4
and a molecular weight of 392.68 g/mol. Its IUPAC name is [4-bromo-4-(4-chlorophenoxy)-2,2-dimethyl-3-oxobutyl] N,N-dimethylcarbamate.
Molecular Properties
| Compound Name | [4-bromo-4-(4-chlorophenoxy)-2,2-dimethyl-3-oxobutyl] N,N-dimethylcarbamate |
| PubChem CID | 21319239 |
| Molecular Formula | C15H19BrClNO4 |
| Molecular Weight | 392.68 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | [4-bromo-4-(4-chlorophenoxy)-2,2-dimethyl-3-oxobutyl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)OCC(C)(C)C(=O)C(Br)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H19BrClNO4/c1-15(2,9-21-14(20)18(3)4)12(19)13(16)22-11-7-5-10(17)6-8-11/h5-8,13H,9H2,1-4H3 |
| InChIKey | KWJMTYXNROIQIU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.68 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [4-bromo-4-(4-chlorophenoxy)-2,2-dimethyl-3-oxobutyl] N,N-dimethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-bromo-4-(4-chlorophenoxy)-2,2-dimethyl-3-oxobutyl] N,N-dimethylcarbamate?
The IUPAC name of [4-bromo-4-(4-chlorophenoxy)-2,2-dimethyl-3-oxobutyl] N,N-dimethylcarbamate (CID 21319239) is [4-bromo-4-(4-chlorophenoxy)-2,2-dimethyl-3-oxobutyl] N,N-dimethylcarbamate.
What is the SMILES notation for [4-bromo-4-(4-chlorophenoxy)-2,2-dimethyl-3-oxobutyl] N,N-dimethylcarbamate?
The canonical SMILES for [4-bromo-4-(4-chlorophenoxy)-2,2-dimethyl-3-oxobutyl] N,N-dimethylcarbamate is CN(C)C(=O)OCC(C)(C)C(=O)C(Br)Oc1ccc(Cl)cc1.
What is the InChIKey of [4-bromo-4-(4-chlorophenoxy)-2,2-dimethyl-3-oxobutyl] N,N-dimethylcarbamate?
The InChIKey is KWJMTYXNROIQIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19BrClNO4/c1-15(2,9-21-14(20)18(3)4)12(19)13(16)22-11-7-5-10(17)6-8-11/h5-8,13H,9H2,1-4H3.
What are the key properties of [4-bromo-4-(4-chlorophenoxy)-2,2-dimethyl-3-oxobutyl] N,N-dimethylcarbamate?
[4-bromo-4-(4-chlorophenoxy)-2,2-dimethyl-3-oxobutyl] N,N-dimethylcarbamate has a molecular weight of 392.68 g/mol, XLogP of 3.73, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-bromo-4-(4-chlorophenoxy)-2,2-dimethyl-3-oxobutyl] N,N-dimethylcarbamate is sourced from PubChem (CID 21319239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).