C20H18BrCl3O4 — CID 54237421
[4-bromo-4-(2,4-dichlorophenoxy)-2,2-dimethyl-3-oxobutyl] 2-(4-chlorophenyl)acetate (PubChem CID 54237421) has the molecular formula C20H18BrCl3O4 and a molecular weight of 508.62 g/mol. Its IUPAC name is [4-bromo-4-(2,4-dichlorophenoxy)-2,2-dimethyl-3-oxobutyl] 2-(4-chlorophenyl)acetate.
| Compound Name | [4-bromo-4-(2,4-dichlorophenoxy)-2,2-dimethyl-3-oxobutyl] 2-(4-chlorophenyl)acetate |
|---|---|
| PubChem CID | 54237421 |
| Molecular Formula | C20H18BrCl3O4 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 505.95 |
| IUPAC Name | [4-bromo-4-(2,4-dichlorophenoxy)-2,2-dimethyl-3-oxobutyl] 2-(4-chlorophenyl)acetate |
| SMILES | CC(C)(COC(=O)Cc1ccc(Cl)cc1)C(=O)C(Br)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H18BrCl3O4/c1-20(2,11-27-17(25)9-12-3-5-13(22)6-4-12)18(26)19(21)28-16-8-7-14(23)10-15(16)24/h3-8,10,19H,9,11H2,1-2H3 |
| InChIKey | QNOAXTLTVKSPKJ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|