C14H15BrClNO2 — CID 13025695
2-bromo-2-(4-chlorophenoxy)-N,N-bis(prop-2-enyl)acetamide (PubChem CID 13025695) has the molecular formula C14H15BrClNO2 and a molecular weight of 344.64 g/mol. Its IUPAC name is 2-bromo-2-(4-chlorophenoxy)-N,N-bis(prop-2-enyl)acetamide.
| Compound Name | 2-bromo-2-(4-chlorophenoxy)-N,N-bis(prop-2-enyl)acetamide |
|---|---|
| PubChem CID | 13025695 |
| Molecular Formula | C14H15BrClNO2 |
| Molecular Weight | 344.64 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | 2-bromo-2-(4-chlorophenoxy)-N,N-bis(prop-2-enyl)acetamide |
| SMILES | C=CCN(CC=C)C(=O)C(Br)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H15BrClNO2/c1-3-9-17(10-4-2)14(18)13(15)19-12-7-5-11(16)6-8-12/h3-8,13H,1-2,9-10H2 |
| InChIKey | MJNQDJCHRCKQLF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.64 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|