C23H35NO5 — CID 123976340
[3-amino-1-(4-methoxy-1-methylcyclohexyl)-3-oxo-2-(1,3,6-trimethylcyclohexa-2,4-dien-1-yl)prop-1-enyl] ethyl carbonate (PubChem CID 123976340) has the molecular formula C23H35NO5 and a molecular weight of 405.54 g/mol. Its IUPAC name is [3-amino-1-(4-methoxy-1-methylcyclohexyl)-3-oxo-2-(1,3,6-trimethylcyclohexa-2,4-dien-1-yl)prop-1-enyl] ethyl carbonate.
| Compound Name | [3-amino-1-(4-methoxy-1-methylcyclohexyl)-3-oxo-2-(1,3,6-trimethylcyclohexa-2,4-dien-1-yl)prop-1-enyl] ethyl carbonate |
|---|---|
| PubChem CID | 123976340 |
| Molecular Formula | C23H35NO5 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | [3-amino-1-(4-methoxy-1-methylcyclohexyl)-3-oxo-2-(1,3,6-trimethylcyclohexa-2,4-dien-1-yl)prop-1-enyl] ethyl carbonate |
| SMILES | CCOC(=O)OC(=C(C(N)=O)C1(C)C=C(C)C=CC1C)C1(C)CCC(OC)CC1 |
| InChI | InChI=1S/C23H35NO5/c1-7-28-21(26)29-19(22(4)12-10-17(27-6)11-13-22)18(20(24)25)23(5)14-15(2)8-9-16(23)3/h8-9,14,16-17H,7,10-13H2,1-6H3,(H2,24,25) |
| InChIKey | KIGVTKGLRUSPCO-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|