C23H32O5 — CID 70991670
[(E)-2-(2,5-dimethylphenyl)-1-(4-methoxy-1-methylcyclohexyl)-3-oxobut-1-enyl] ethyl carbonate (PubChem CID 70991670) has the molecular formula C23H32O5 and a molecular weight of 388.50 g/mol. Its IUPAC name is [(E)-2-(2,5-dimethylphenyl)-1-(4-methoxy-1-methylcyclohexyl)-3-oxobut-1-enyl] ethyl carbonate.
| Compound Name | [(E)-2-(2,5-dimethylphenyl)-1-(4-methoxy-1-methylcyclohexyl)-3-oxobut-1-enyl] ethyl carbonate |
|---|---|
| PubChem CID | 70991670 |
| Molecular Formula | C23H32O5 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | [(E)-2-(2,5-dimethylphenyl)-1-(4-methoxy-1-methylcyclohexyl)-3-oxobut-1-enyl] ethyl carbonate |
| SMILES | CCOC(=O)O/C(=C(/C(C)=O)c1cc(C)ccc1C)C1(C)CCC(OC)CC1 |
| InChI | InChI=1S/C23H32O5/c1-7-27-22(25)28-21(23(5)12-10-18(26-6)11-13-23)20(17(4)24)19-14-15(2)8-9-16(19)3/h8-9,14,18H,7,10-13H2,1-6H3/b21-20- |
| InChIKey | ZCVBCXMFIQFSOI-MRCUWXFGSA-N |
| XLogP | 5.37 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|