C19H27NO3 — CID 55315017
[2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 2,5-dimethylbenzoate (PubChem CID 55315017) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 2,5-dimethylbenzoate.
| Compound Name | [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 2,5-dimethylbenzoate |
|---|---|
| PubChem CID | 55315017 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 2,5-dimethylbenzoate |
| SMILES | CCN(C(=O)COC(=O)c1cc(C)ccc1C)C1CCCCC1 |
| InChI | InChI=1S/C19H27NO3/c1-4-20(16-8-6-5-7-9-16)18(21)13-23-19(22)17-12-14(2)10-11-15(17)3/h10-12,16H,4-9,13H2,1-3H3 |
| InChIKey | CDECQSUZXIAUFT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |