C22H28N2O5 — CID 46816551
[2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 3-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 46816551) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 3-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 3-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 46816551 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 3-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | CCN(C(=O)COC(=O)CCN1C(=O)c2ccc(C)cc2C1=O)C1CCCCC1 |
| InChI | InChI=1S/C22H28N2O5/c1-3-23(16-7-5-4-6-8-16)19(25)14-29-20(26)11-12-24-21(27)17-10-9-15(2)13-18(17)22(24)28/h9-10,13,16H,3-8,11-12,14H2,1-2H3 |
| InChIKey | UXDZJKRBLGSGGX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|