C16H24N2O3 — CID 55307564
[2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate (PubChem CID 55307564) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate.
| Compound Name | [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 55307564 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate |
| SMILES | CCN(C(=O)COC(=O)c1cccn1C)C1CCCCC1 |
| InChI | InChI=1S/C16H24N2O3/c1-3-18(13-8-5-4-6-9-13)15(19)12-21-16(20)14-10-7-11-17(14)2/h7,10-11,13H,3-6,8-9,12H2,1-2H3 |
| InChIKey | DMHGYFAYEFUPRG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |