C32H43ClO6 — CID 123977611
methyl (4aS,6aR,6bS,8aR,9S,12aS,14aR,14bS)-12-(chloromethylidene)-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-10,11,14-trioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-4a-carboxylate (PubChem CID 123977611) has the molecular formula C32H43ClO6 and a molecular weight of 559.14 g/mol. Its IUPAC name is methyl (4aS,6aR,6bS,8aR,9S,12aS,14aR,14bS)-12-(chloromethylidene)-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-10,11,14-trioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-4a-carboxylate.
| Compound Name | methyl (4aS,6aR,6bS,8aR,9S,12aS,14aR,14bS)-12-(chloromethylidene)-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-10,11,14-trioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-4a-carboxylate |
|---|---|
| PubChem CID | 123977611 |
| Molecular Formula | C32H43ClO6 |
| Molecular Weight | 559.14 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | methyl (4aS,6aR,6bS,8aR,9S,12aS,14aR,14bS)-12-(chloromethylidene)-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-10,11,14-trioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-4a-carboxylate |
| SMILES | COC(=O)[C@]12CCC(C)(C)C[C@H]1[C@H]1C(=O)C=C3[C@@]4(C)C(=CCl)C(=O)C(=O)[C@](C)(CO)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C32H43ClO6/c1-27(2)10-12-32(26(38)39-7)13-11-30(5)23(18(32)15-27)20(35)14-22-29(30,4)9-8-21-28(3,17-34)25(37)24(36)19(16-33)31(21,22)6/h14,16,18,21,23,34H,8-13,15,17H2,1-7H3/t18-,21-,23-,28+,29+,30+,31-,32-/m0/s1 |
| InChIKey | NPFLACSOROKVOA-VXLDZUHRSA-N |
| XLogP | 5.59 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.14 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|