C15H14FN3 — CID 123979130
1-benzyl-4-(4-fluorophenyl)-4,5-dihydrotriazole (PubChem CID 123979130) has the molecular formula C15H14FN3 and a molecular weight of 255.30 g/mol. Its IUPAC name is 1-benzyl-4-(4-fluorophenyl)-4,5-dihydrotriazole.
| Compound Name | 1-benzyl-4-(4-fluorophenyl)-4,5-dihydrotriazole |
|---|---|
| PubChem CID | 123979130 |
| Molecular Formula | C15H14FN3 |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 1-benzyl-4-(4-fluorophenyl)-4,5-dihydrotriazole |
| SMILES | Fc1ccc(C2CN(Cc3ccccc3)N=N2)cc1 |
| InChI | InChI=1S/C15H14FN3/c16-14-8-6-13(7-9-14)15-11-19(18-17-15)10-12-4-2-1-3-5-12/h1-9,15H,10-11H2 |
| InChIKey | IIZBWSFONZOPNM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |