C19H22FNO — CID 67131561
(1R)-1-[(3R,4S)-1-benzyl-4-(4-fluorophenyl)pyrrolidin-3-yl]ethanol (PubChem CID 67131561) has the molecular formula C19H22FNO and a molecular weight of 299.39 g/mol. Its IUPAC name is (1R)-1-[(3R,4S)-1-benzyl-4-(4-fluorophenyl)pyrrolidin-3-yl]ethanol.
| Compound Name | (1R)-1-[(3R,4S)-1-benzyl-4-(4-fluorophenyl)pyrrolidin-3-yl]ethanol |
|---|---|
| PubChem CID | 67131561 |
| Molecular Formula | C19H22FNO |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | (1R)-1-[(3R,4S)-1-benzyl-4-(4-fluorophenyl)pyrrolidin-3-yl]ethanol |
| SMILES | C[C@@H](O)[C@H]1CN(Cc2ccccc2)C[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C19H22FNO/c1-14(22)18-12-21(11-15-5-3-2-4-6-15)13-19(18)16-7-9-17(20)10-8-16/h2-10,14,18-19,22H,11-13H2,1H3/t14-,18-,19-/m1/s1 |
| InChIKey | AICDORFYMOHSSB-NIKGAXFTSA-N |
| XLogP | 3.42 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |