C19H22ClNO2 — CID 59438124
[(3S,4S)-1-benzyl-3-(4-chlorophenyl)piperidin-4-yl]methanediol (PubChem CID 59438124) has the molecular formula C19H22ClNO2 and a molecular weight of 331.84 g/mol. Its IUPAC name is [(3S,4S)-1-benzyl-3-(4-chlorophenyl)piperidin-4-yl]methanediol.
| Compound Name | [(3S,4S)-1-benzyl-3-(4-chlorophenyl)piperidin-4-yl]methanediol |
|---|---|
| PubChem CID | 59438124 |
| Molecular Formula | C19H22ClNO2 |
| Molecular Weight | 331.84 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | [(3S,4S)-1-benzyl-3-(4-chlorophenyl)piperidin-4-yl]methanediol |
| SMILES | OC(O)[C@H]1CCN(Cc2ccccc2)C[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H22ClNO2/c20-16-8-6-15(7-9-16)18-13-21(11-10-17(18)19(22)23)12-14-4-2-1-3-5-14/h1-9,17-19,22-23H,10-13H2/t17-,18+/m0/s1 |
| InChIKey | SAJHSCHNNHFVAV-ZWKOTPCHSA-N |
| XLogP | 3.26 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.84 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|