C20H24ClN — CID 91295133
3-(4-chlorophenyl)-4-methyl-1-(2-phenylethyl)piperidine (PubChem CID 91295133) has the molecular formula C20H24ClN and a molecular weight of 313.87 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-methyl-1-(2-phenylethyl)piperidine.
| Compound Name | 3-(4-chlorophenyl)-4-methyl-1-(2-phenylethyl)piperidine |
|---|---|
| PubChem CID | 91295133 |
| Molecular Formula | C20H24ClN |
| Molecular Weight | 313.87 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 3-(4-chlorophenyl)-4-methyl-1-(2-phenylethyl)piperidine |
| SMILES | CC1CCN(CCc2ccccc2)CC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H24ClN/c1-16-11-13-22(14-12-17-5-3-2-4-6-17)15-20(16)18-7-9-19(21)10-8-18/h2-10,16,20H,11-15H2,1H3 |
| InChIKey | MWMRQSYXHQZCMS-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.87 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |