C27H26ClFN2OS — CID 89396419
N-(4-chlorobenzenecarbothioyl)-3-(4-fluorophenyl)-1-(2-phenylethyl)piperidine-4-carboxamide (PubChem CID 89396419) has the molecular formula C27H26ClFN2OS and a molecular weight of 481.04 g/mol. Its IUPAC name is N-(4-chlorobenzenecarbothioyl)-3-(4-fluorophenyl)-1-(2-phenylethyl)piperidine-4-carboxamide.
| Compound Name | N-(4-chlorobenzenecarbothioyl)-3-(4-fluorophenyl)-1-(2-phenylethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 89396419 |
| Molecular Formula | C27H26ClFN2OS |
| Molecular Weight | 481.04 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | N-(4-chlorobenzenecarbothioyl)-3-(4-fluorophenyl)-1-(2-phenylethyl)piperidine-4-carboxamide |
| SMILES | O=C(NC(=S)c1ccc(Cl)cc1)C1CCN(CCc2ccccc2)CC1c1ccc(F)cc1 |
| InChI | InChI=1S/C27H26ClFN2OS/c28-22-10-6-21(7-11-22)27(33)30-26(32)24-15-17-31(16-14-19-4-2-1-3-5-19)18-25(24)20-8-12-23(29)13-9-20/h1-13,24-25H,14-18H2,(H,30,32,33) |
| InChIKey | LQOMHAMLISHIRO-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.04 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|