C23H25ClFNO3 — CID 59878462
methyl 4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-oxobutyl]piperidine-3-carboxylate (PubChem CID 59878462) has the molecular formula C23H25ClFNO3 and a molecular weight of 417.91 g/mol. Its IUPAC name is methyl 4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-oxobutyl]piperidine-3-carboxylate.
| Compound Name | methyl 4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-oxobutyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 59878462 |
| Molecular Formula | C23H25ClFNO3 |
| Molecular Weight | 417.91 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | methyl 4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-oxobutyl]piperidine-3-carboxylate |
| SMILES | COC(=O)C1CN(CCCC(=O)c2ccc(F)cc2)CCC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H25ClFNO3/c1-29-23(28)21-15-26(14-12-20(21)16-4-8-18(24)9-5-16)13-2-3-22(27)17-6-10-19(25)11-7-17/h4-11,20-21H,2-3,12-15H2,1H3 |
| InChIKey | NTRJPVVVKBGNIN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.91 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |