C21H24FNO3 — CID 95560254
1-(4-fluorophenyl)-4-[(3S)-3-(3-methoxyphenoxy)pyrrolidin-1-yl]butan-1-one (PubChem CID 95560254) has the molecular formula C21H24FNO3 and a molecular weight of 357.43 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-[(3S)-3-(3-methoxyphenoxy)pyrrolidin-1-yl]butan-1-one.
| Compound Name | 1-(4-fluorophenyl)-4-[(3S)-3-(3-methoxyphenoxy)pyrrolidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 95560254 |
| Molecular Formula | C21H24FNO3 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 1-(4-fluorophenyl)-4-[(3S)-3-(3-methoxyphenoxy)pyrrolidin-1-yl]butan-1-one |
| SMILES | COc1cccc(O[C@H]2CCN(CCCC(=O)c3ccc(F)cc3)C2)c1 |
| InChI | InChI=1S/C21H24FNO3/c1-25-18-4-2-5-19(14-18)26-20-11-13-23(15-20)12-3-6-21(24)16-7-9-17(22)10-8-16/h2,4-5,7-10,14,20H,3,6,11-13,15H2,1H3/t20-/m0/s1 |
| InChIKey | BOYHRGVIIMUTCP-FQEVSTJZSA-N |
| XLogP | 3.95 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |