C22H26FNO4 — CID 10110762
1-(4-fluorophenyl)-4-[2-[(3-methoxyphenoxy)methyl]morpholin-4-yl]butan-1-one (PubChem CID 10110762) has the molecular formula C22H26FNO4 and a molecular weight of 387.45 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-[2-[(3-methoxyphenoxy)methyl]morpholin-4-yl]butan-1-one.
| Compound Name | 1-(4-fluorophenyl)-4-[2-[(3-methoxyphenoxy)methyl]morpholin-4-yl]butan-1-one |
|---|---|
| PubChem CID | 10110762 |
| Molecular Formula | C22H26FNO4 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 1-(4-fluorophenyl)-4-[2-[(3-methoxyphenoxy)methyl]morpholin-4-yl]butan-1-one |
| SMILES | COc1cccc(OCC2CN(CCCC(=O)c3ccc(F)cc3)CCO2)c1 |
| InChI | InChI=1S/C22H26FNO4/c1-26-19-4-2-5-20(14-19)28-16-21-15-24(12-13-27-21)11-3-6-22(25)17-7-9-18(23)10-8-17/h2,4-5,7-10,14,21H,3,6,11-13,15-16H2,1H3 |
| InChIKey | YFTQNRHGWPTKFK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |