C17H17ClNNaO2S — CID 165455948
sodium (3S,4R)-1-benzyl-4-(4-chlorophenyl)pyrrolidine-3-sulfinate (PubChem CID 165455948) has the molecular formula C17H17ClNNaO2S and a molecular weight of 357.84 g/mol. Its IUPAC name is sodium (3S,4R)-1-benzyl-4-(4-chlorophenyl)pyrrolidine-3-sulfinate.
| Compound Name | sodium (3S,4R)-1-benzyl-4-(4-chlorophenyl)pyrrolidine-3-sulfinate |
|---|---|
| PubChem CID | 165455948 |
| Molecular Formula | C17H17ClNNaO2S |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | sodium (3S,4R)-1-benzyl-4-(4-chlorophenyl)pyrrolidine-3-sulfinate |
| SMILES | O=S([O-])[C@@H]1CN(Cc2ccccc2)C[C@H]1c1ccc(Cl)cc1.[Na+] |
| InChI | InChI=1S/C17H18ClNO2S.Na/c18-15-8-6-14(7-9-15)16-11-19(12-17(16)22(20)21)10-13-4-2-1-3-5-13;/h1-9,16-17H,10-12H2,(H,20,21);/q;+1/p-1/t16-,17+;/m0./s1 |
| InChIKey | POVUCMXTPBJJNT-MCJVGQIASA-M |
| XLogP | 0.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|