C18H19BrN2 — CID 123979808
8-bromo-3-(1-methylpyrrolidin-2-yl)-1,2-dihydrobenzo[f]quinoline (PubChem CID 123979808) has the molecular formula C18H19BrN2 and a molecular weight of 343.27 g/mol. Its IUPAC name is 8-bromo-3-(1-methylpyrrolidin-2-yl)-1,2-dihydrobenzo[f]quinoline.
| Compound Name | 8-bromo-3-(1-methylpyrrolidin-2-yl)-1,2-dihydrobenzo[f]quinoline |
|---|---|
| PubChem CID | 123979808 |
| Molecular Formula | C18H19BrN2 |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 8-bromo-3-(1-methylpyrrolidin-2-yl)-1,2-dihydrobenzo[f]quinoline |
| SMILES | CN1CCCC1C1=Nc2ccc3cc(Br)ccc3c2CC1 |
| InChI | InChI=1S/C18H19BrN2/c1-21-10-2-3-18(21)17-9-7-15-14-6-5-13(19)11-12(14)4-8-16(15)20-17/h4-6,8,11,18H,2-3,7,9-10H2,1H3 |
| InChIKey | CUVYLIBYFIZHCM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |