C28H30BrIN2 — CID 139224263
(2E)-2-[(5-bromo-1-ethyl-3,3-dimethylindol-1-ium-2-yl)methylidene]-1-butylbenzo[cd]indole iodide (PubChem CID 139224263) has the molecular formula C28H30BrIN2 and a molecular weight of 601.37 g/mol. Its IUPAC name is (2E)-2-[(5-bromo-1-ethyl-3,3-dimethylindol-1-ium-2-yl)methylidene]-1-butylbenzo[cd]indole iodide.
| Compound Name | (2E)-2-[(5-bromo-1-ethyl-3,3-dimethylindol-1-ium-2-yl)methylidene]-1-butylbenzo[cd]indole iodide |
|---|---|
| PubChem CID | 139224263 |
| Molecular Formula | C28H30BrIN2 |
| Molecular Weight | 601.37 g/mol |
| Exact Mass | 600.06 |
| IUPAC Name | (2E)-2-[(5-bromo-1-ethyl-3,3-dimethylindol-1-ium-2-yl)methylidene]-1-butylbenzo[cd]indole iodide |
| SMILES | CCCCn1/c(=C/C2=[N+](CC)c3ccc(Br)cc3C2(C)C)c2cccc3cccc1c32.[I-] |
| InChI | InChI=1S/C28H30BrN2.HI/c1-5-7-16-31-24-13-9-11-19-10-8-12-21(27(19)24)25(31)18-26-28(3,4)22-17-20(29)14-15-23(22)30(26)6-2;/h8-15,17-18H,5-7,16H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | IJXJYTXHXYSESB-UHFFFAOYSA-M |
| XLogP | 3.96 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|