C14H21N5O4 — CID 123980053
methyl 2-(11,12-dimethyl-7,14-dioxo-1,3,5,8,12-pentazatricyclo[6.5.1.02,6]tetradec-3-en-5-yl)acetate (PubChem CID 123980053) has the molecular formula C14H21N5O4 and a molecular weight of 323.35 g/mol. Its IUPAC name is methyl 2-(11,12-dimethyl-7,14-dioxo-1,3,5,8,12-pentazatricyclo[6.5.1.02,6]tetradec-3-en-5-yl)acetate.
| Compound Name | methyl 2-(11,12-dimethyl-7,14-dioxo-1,3,5,8,12-pentazatricyclo[6.5.1.02,6]tetradec-3-en-5-yl)acetate |
|---|---|
| PubChem CID | 123980053 |
| Molecular Formula | C14H21N5O4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | methyl 2-(11,12-dimethyl-7,14-dioxo-1,3,5,8,12-pentazatricyclo[6.5.1.02,6]tetradec-3-en-5-yl)acetate |
| SMILES | COC(=O)CN1C=NC2C1C(=O)N1CCC(C)N(C)CN2C1=O |
| InChI | InChI=1S/C14H21N5O4/c1-9-4-5-18-13(21)11-12(19(14(18)22)8-16(9)2)15-7-17(11)6-10(20)23-3/h7,9,11-12H,4-6,8H2,1-3H3 |
| InChIKey | BAPJLDNHMBQLCQ-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 85.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |