C9H12N4O4 — CID 167999631
methyl 2-(3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetate (PubChem CID 167999631) has the molecular formula C9H12N4O4 and a molecular weight of 240.22 g/mol. Its IUPAC name is methyl 2-(3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetate.
| Compound Name | methyl 2-(3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetate |
|---|---|
| PubChem CID | 167999631 |
| Molecular Formula | C9H12N4O4 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | methyl 2-(3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetate |
| SMILES | COC(=O)CN1C=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C9H12N4O4/c1-12-7-6(8(15)11-9(12)16)13(4-10-7)3-5(14)17-2/h4,6-7H,3H2,1-2H3,(H,11,15,16) |
| InChIKey | AEKCEONICCYRDF-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |