C10H14N4O4 — CID 178188745
methyl (2S)-2-(3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)propanoate (PubChem CID 178188745) has the molecular formula C10H14N4O4 and a molecular weight of 254.25 g/mol. Its IUPAC name is methyl (2S)-2-(3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)propanoate.
| Compound Name | methyl (2S)-2-(3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)propanoate |
|---|---|
| PubChem CID | 178188745 |
| Molecular Formula | C10H14N4O4 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | methyl (2S)-2-(3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)propanoate |
| SMILES | COC(=O)[C@H](C)N1C=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C10H14N4O4/c1-5(9(16)18-3)14-4-11-7-6(14)8(15)12-10(17)13(7)2/h4-7H,1-3H3,(H,12,15,17)/t5-,6?,7?/m0/s1 |
| InChIKey | DFPVKPOIVLJXSC-VTSJMVTISA-N |
| XLogP | -1.23 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |