C12H20O3 — CID 123981001
2,4-dimethyl-4-(3-oxopentan-2-yloxy)pent-1-en-3-one (PubChem CID 123981001) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is 2,4-dimethyl-4-(3-oxopentan-2-yloxy)pent-1-en-3-one.
| Compound Name | 2,4-dimethyl-4-(3-oxopentan-2-yloxy)pent-1-en-3-one |
|---|---|
| PubChem CID | 123981001 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 2,4-dimethyl-4-(3-oxopentan-2-yloxy)pent-1-en-3-one |
| SMILES | C=C(C)C(=O)C(C)(C)OC(C)C(=O)CC |
| InChI | InChI=1S/C12H20O3/c1-7-10(13)9(4)15-12(5,6)11(14)8(2)3/h9H,2,7H2,1,3-6H3 |
| InChIKey | GSBKWNMSADOOJN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|