C20H17N3O4 — CID 123983952
N-(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)-4-(4-imino-3-oxobut-1-enyl)benzamide (PubChem CID 123983952) has the molecular formula C20H17N3O4 and a molecular weight of 363.37 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)-4-(4-imino-3-oxobut-1-enyl)benzamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)-4-(4-imino-3-oxobut-1-enyl)benzamide |
|---|---|
| PubChem CID | 123983952 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)-4-(4-imino-3-oxobut-1-enyl)benzamide |
| SMILES | [H]/N=C/C(=O)C=Cc1ccc(C(=O)NN=Cc2ccc3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C20H17N3O4/c21-12-17(24)7-3-14-1-5-16(6-2-14)20(25)23-22-13-15-4-8-18-19(11-15)27-10-9-26-18/h1-8,11-13,21H,9-10H2,(H,23,25)/b7-3?,21-12+,22-13? |
| InChIKey | ATENEFPRQPPTQB-MREZKOIESA-N |
| XLogP | 2.45 |
| TPSA | 100.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|