C20H22N6O2S2 — CID 123985202
6-[[11-[2-(2-hydroxyethylamino)ethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]amino]-3H-1,3-benzothiazol-2-one (PubChem CID 123985202) has the molecular formula C20H22N6O2S2 and a molecular weight of 442.57 g/mol. Its IUPAC name is 6-[[11-[2-(2-hydroxyethylamino)ethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]amino]-3H-1,3-benzothiazol-2-one.
| Compound Name | 6-[[11-[2-(2-hydroxyethylamino)ethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]amino]-3H-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 123985202 |
| Molecular Formula | C20H22N6O2S2 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 6-[[11-[2-(2-hydroxyethylamino)ethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]amino]-3H-1,3-benzothiazol-2-one |
| SMILES | O=c1[nH]c2ccc(Nc3ncnc4sc5c(c34)CCN(CCNCCO)C5)cc2s1 |
| InChI | InChI=1S/C20H22N6O2S2/c27-8-5-21-4-7-26-6-3-13-16(10-26)29-19-17(13)18(22-11-23-19)24-12-1-2-14-15(9-12)30-20(28)25-14/h1-2,9,11,21,27H,3-8,10H2,(H,25,28)(H,22,23,24) |
| InChIKey | NLPHCSUMPBRQNK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 106.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|