C9H13NO — CID 123985714
3-methoxy-4-methylcyclohepta-2,6-dien-1-imine (PubChem CID 123985714) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 3-methoxy-4-methylcyclohepta-2,6-dien-1-imine.
| Compound Name | 3-methoxy-4-methylcyclohepta-2,6-dien-1-imine |
|---|---|
| PubChem CID | 123985714 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 3-methoxy-4-methylcyclohepta-2,6-dien-1-imine |
| SMILES | [H]/N=C1\C=CCC(C)C(OC)=C1 |
| InChI | InChI=1S/C9H13NO/c1-7-4-3-5-8(10)6-9(7)11-2/h3,5-7,10H,4H2,1-2H3/b10-8+ |
| InChIKey | FWSCMDSYWIQKEM-CSKARUKUSA-N |
| XLogP | 2.13 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|