C10H15NO — CID 165128699
(3E)-3-ethenoxyocta-3,7-dien-2-imine (PubChem CID 165128699) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (3E)-3-ethenoxyocta-3,7-dien-2-imine.
| Compound Name | (3E)-3-ethenoxyocta-3,7-dien-2-imine |
|---|---|
| PubChem CID | 165128699 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (3E)-3-ethenoxyocta-3,7-dien-2-imine |
| SMILES | [H]/N=C(C)/C(=C\CCC=C)OC=C |
| InChI | InChI=1S/C10H15NO/c1-4-6-7-8-10(9(3)11)12-5-2/h4-5,8,11H,1-2,6-7H2,3H3/b10-8+,11-9+ |
| InChIKey | XEPWPFZPOZTPBS-GFULKKFKSA-N |
| XLogP | 3.04 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|