C11H17NO — CID 123216771
3-(2-methylpropoxy)cyclohepta-2,6-dien-1-imine (PubChem CID 123216771) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 3-(2-methylpropoxy)cyclohepta-2,6-dien-1-imine.
| Compound Name | 3-(2-methylpropoxy)cyclohepta-2,6-dien-1-imine |
|---|---|
| PubChem CID | 123216771 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 3-(2-methylpropoxy)cyclohepta-2,6-dien-1-imine |
| SMILES | [H]/N=C1\C=CCCC(OCC(C)C)=C1 |
| InChI | InChI=1S/C11H17NO/c1-9(2)8-13-11-6-4-3-5-10(12)7-11/h3,5,7,9,12H,4,6,8H2,1-2H3/b12-10+ |
| InChIKey | FBJAYZBPGDVKKL-ZRDIBKRKSA-N |
| XLogP | 2.91 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|