C12H18O2S2 — CID 10244259
8-(2-methylpropoxy)-1,4-dithiaspiro[4.5]dec-7-en-6-one (PubChem CID 10244259) has the molecular formula C12H18O2S2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 8-(2-methylpropoxy)-1,4-dithiaspiro[4.5]dec-7-en-6-one.
| Compound Name | 8-(2-methylpropoxy)-1,4-dithiaspiro[4.5]dec-7-en-6-one |
|---|---|
| PubChem CID | 10244259 |
| Molecular Formula | C12H18O2S2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 8-(2-methylpropoxy)-1,4-dithiaspiro[4.5]dec-7-en-6-one |
| SMILES | CC(C)COC1=CC(=O)C2(CC1)SCCS2 |
| InChI | InChI=1S/C12H18O2S2/c1-9(2)8-14-10-3-4-12(11(13)7-10)15-5-6-16-12/h7,9H,3-6,8H2,1-2H3 |
| InChIKey | SSMWCFASZRRMJD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |