C12H19NO — CID 123382483
(2E,7Z)-3-(2-methylpropoxy)cycloocta-2,7-dien-1-imine (PubChem CID 123382483) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is (2E,7Z)-3-(2-methylpropoxy)cycloocta-2,7-dien-1-imine.
| Compound Name | (2E,7Z)-3-(2-methylpropoxy)cycloocta-2,7-dien-1-imine |
|---|---|
| PubChem CID | 123382483 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (2E,7Z)-3-(2-methylpropoxy)cycloocta-2,7-dien-1-imine |
| SMILES | [H]/N=C1\C=C/CCC/C(OCC(C)C)=C\1 |
| InChI | InChI=1S/C12H19NO/c1-10(2)9-14-12-7-5-3-4-6-11(13)8-12/h4,6,8,10,13H,3,5,7,9H2,1-2H3/b6-4-,12-8+,13-11+ |
| InChIKey | JPXRTNBKRMURDD-LJVGPELUSA-N |
| XLogP | 3.30 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|