C17H20N4 — CID 123987139
2-[5,6-bis(dimethylamino)-2-pyridinyl]-4-methylbenzonitrile (PubChem CID 123987139) has the molecular formula C17H20N4 and a molecular weight of 280.38 g/mol. Its IUPAC name is 2-[5,6-bis(dimethylamino)-2-pyridinyl]-4-methylbenzonitrile.
| Compound Name | 2-[5,6-bis(dimethylamino)-2-pyridinyl]-4-methylbenzonitrile |
|---|---|
| PubChem CID | 123987139 |
| Molecular Formula | C17H20N4 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 2-[5,6-bis(dimethylamino)-2-pyridinyl]-4-methylbenzonitrile |
| SMILES | Cc1ccc(C#N)c(-c2ccc(N(C)C)c(N(C)C)n2)c1 |
| InChI | InChI=1S/C17H20N4/c1-12-6-7-13(11-18)14(10-12)15-8-9-16(20(2)3)17(19-15)21(4)5/h6-10H,1-5H3 |
| InChIKey | YGRIQILDIIHKHF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 43.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |