C44H38 — CID 123989759
27-(3,5-dimethylphenyl)-5,9,9,17,17,21-hexamethyloctacyclo[13.13.2.02,10.03,8.012,29.016,24.018,23.026,30]triaconta-1(29),2(10),3(8),4,6,11,13,15(30),16(24),18(23),19,21,25,27-tetradecaene (PubChem CID 123989759) has the molecular formula C44H38 and a molecular weight of 566.79 g/mol. Its IUPAC name is 27-(3,5-dimethylphenyl)-5,9,9,17,17,21-hexamethyloctacyclo[13.13.2.02,10.03,8.012,29.016,24.018,23.026,30]triaconta-1(29),2(10),3(8),4,6,11,13,15(30),16(24),18(23),19,21,25,27-tetradecaene.
| Compound Name | 27-(3,5-dimethylphenyl)-5,9,9,17,17,21-hexamethyloctacyclo[13.13.2.02,10.03,8.012,29.016,24.018,23.026,30]triaconta-1(29),2(10),3(8),4,6,11,13,15(30),16(24),18(23),19,21,25,27-tetradecaene |
|---|---|
| PubChem CID | 123989759 |
| Molecular Formula | C44H38 |
| Molecular Weight | 566.79 g/mol |
| Exact Mass | 566.30 |
| IUPAC Name | 27-(3,5-dimethylphenyl)-5,9,9,17,17,21-hexamethyloctacyclo[13.13.2.02,10.03,8.012,29.016,24.018,23.026,30]triaconta-1(29),2(10),3(8),4,6,11,13,15(30),16(24),18(23),19,21,25,27-tetradecaene |
| SMILES | Cc1cc(C)cc(-c2cc3c4c(cc5ccc6c7c(cc2c6c53)-c2cc(C)ccc2C7(C)C)C(C)(C)c2ccc(C)cc2-4)c1 |
| InChI | InChI=1S/C44H38/c1-23-9-13-36-31(18-23)33-22-32-30(28-16-25(3)15-26(4)17-28)21-35-39-27(11-12-29(41(32)39)42(33)44(36,7)8)20-38-40(35)34-19-24(2)10-14-37(34)43(38,5)6/h9-22H,1-8H3 |
| InChIKey | CFDLSBUAWWCKOE-UHFFFAOYSA-N |
| XLogP | 12.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.79 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|